C42H30Cl2FN3O5 — CID 5202022
2-(4-anilinophenyl)-6a,9a-dichloro-8-(4-fluorophenyl)-6-(2-hydroxynaphthalen-1-yl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5202022) has the molecular formula C42H30Cl2FN3O5 and a molecular weight of 746.62 g/mol. Its IUPAC name is 2-(4-anilinophenyl)-6a,9a-dichloro-8-(4-fluorophenyl)-6-(2-hydroxynaphthalen-1-yl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-anilinophenyl)-6a,9a-dichloro-8-(4-fluorophenyl)-6-(2-hydroxynaphthalen-1-yl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5202022 |
| Molecular Formula | C42H30Cl2FN3O5 |
| Molecular Weight | 746.62 g/mol |
| Exact Mass | 745.15 |
| IUPAC Name | 2-(4-anilinophenyl)-6a,9a-dichloro-8-(4-fluorophenyl)-6-(2-hydroxynaphthalen-1-yl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4(Cl)C(=O)N(c5ccc(F)cc5)C(=O)C4(Cl)C3c3c(O)ccc4ccccc34)C2C(=O)N1c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C42H30Cl2FN3O5/c43-41-22-32-30(19-20-31-34(32)38(51)47(37(31)50)27-17-13-26(14-18-27)46-25-7-2-1-3-8-25)36(35-29-9-5-4-6-23(29)10-21-33(35)49)42(41,44)40(53)48(39(41)52)28-15-11-24(45)12-16-28/h1-19,21,31-32,34,36,46,49H,20,22H2 |
| InChIKey | JDAGBJOHJOJVFS-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.62 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|