C34H28BrCl2N3O6 — CID 4079429
2-(4-anilinophenyl)-8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-6-methoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4079429) has the molecular formula C34H28BrCl2N3O6 and a molecular weight of 725.42 g/mol. Its IUPAC name is 2-(4-anilinophenyl)-8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-6-methoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-anilinophenyl)-8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-6-methoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4079429 |
| Molecular Formula | C34H28BrCl2N3O6 |
| Molecular Weight | 725.42 g/mol |
| Exact Mass | 723.05 |
| IUPAC Name | 2-(4-anilinophenyl)-8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-6-methoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cccc(O)c1C1C2=CCC3C(=O)N(c4ccc(Nc5ccccc5)cc4)C(=O)C3C2CC2(Cl)C(=O)N(CBr)C(=O)C12Cl |
| InChI | InChI=1S/C34H28BrCl2N3O6/c1-46-25-9-5-8-24(41)27(25)28-21-14-15-22-26(23(21)16-33(36)31(44)39(17-35)32(45)34(28,33)37)30(43)40(29(22)42)20-12-10-19(11-13-20)38-18-6-3-2-4-7-18/h2-14,22-23,26,28,38,41H,15-17H2,1H3 |
| InChIKey | XSDUNSNNOURNKH-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.42 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|