C33H26BrCl2N3O5 — CID 4150630
2-(4-anilinophenyl)-8-(bromomethyl)-6a,9a-dichloro-6-(3-hydroxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4150630) has the molecular formula C33H26BrCl2N3O5 and a molecular weight of 695.40 g/mol. Its IUPAC name is 2-(4-anilinophenyl)-8-(bromomethyl)-6a,9a-dichloro-6-(3-hydroxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-anilinophenyl)-8-(bromomethyl)-6a,9a-dichloro-6-(3-hydroxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4150630 |
| Molecular Formula | C33H26BrCl2N3O5 |
| Molecular Weight | 695.40 g/mol |
| Exact Mass | 693.04 |
| IUPAC Name | 2-(4-anilinophenyl)-8-(bromomethyl)-6a,9a-dichloro-6-(3-hydroxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4(Cl)C(=O)N(CBr)C(=O)C4(Cl)C3c3cccc(O)c3)C2C(=O)N1c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C33H26BrCl2N3O5/c34-17-38-30(43)32(35)16-25-23(27(33(32,36)31(38)44)18-5-4-8-22(40)15-18)13-14-24-26(25)29(42)39(28(24)41)21-11-9-20(10-12-21)37-19-6-2-1-3-7-19/h1-13,15,24-27,37,40H,14,16-17H2 |
| InChIKey | WEVNAXSIETUBLH-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.40 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|