C27H20BrCl3N2O5 — CID 3271935
8-(bromomethyl)-6a,9a-dichloro-6-(2-chloro-4-hydroxyphenyl)-2-phenyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3271935) has the molecular formula C27H20BrCl3N2O5 and a molecular weight of 638.73 g/mol. Its IUPAC name is 8-(bromomethyl)-6a,9a-dichloro-6-(2-chloro-4-hydroxyphenyl)-2-phenyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(bromomethyl)-6a,9a-dichloro-6-(2-chloro-4-hydroxyphenyl)-2-phenyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3271935 |
| Molecular Formula | C27H20BrCl3N2O5 |
| Molecular Weight | 638.73 g/mol |
| Exact Mass | 635.96 |
| IUPAC Name | 8-(bromomethyl)-6a,9a-dichloro-6-(2-chloro-4-hydroxyphenyl)-2-phenyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4(Cl)C(=O)N(CBr)C(=O)C4(Cl)C3c3ccc(O)cc3Cl)C2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C27H20BrCl3N2O5/c28-12-32-24(37)26(30)11-18-15(21(27(26,31)25(32)38)16-7-6-14(34)10-19(16)29)8-9-17-20(18)23(36)33(22(17)35)13-4-2-1-3-5-13/h1-8,10,17-18,20-21,34H,9,11-12H2 |
| InChIKey | UTQOSPNLBAOFNH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.73 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|