C31H28BrCl2N3O6 — CID 3343616
8-(bromomethyl)-6a,9a-dichloro-6-(3-hydroxyphenyl)-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3343616) has the molecular formula C31H28BrCl2N3O6 and a molecular weight of 689.39 g/mol. Its IUPAC name is 8-(bromomethyl)-6a,9a-dichloro-6-(3-hydroxyphenyl)-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(bromomethyl)-6a,9a-dichloro-6-(3-hydroxyphenyl)-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3343616 |
| Molecular Formula | C31H28BrCl2N3O6 |
| Molecular Weight | 689.39 g/mol |
| Exact Mass | 687.05 |
| IUPAC Name | 8-(bromomethyl)-6a,9a-dichloro-6-(3-hydroxyphenyl)-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4(Cl)C(=O)N(CBr)C(=O)C4(Cl)C3c3cccc(O)c3)C2C(=O)N1c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C31H28BrCl2N3O6/c32-16-36-28(41)30(33)15-23-21(25(31(30,34)29(36)42)17-2-1-3-20(38)14-17)8-9-22-24(23)27(40)37(26(22)39)19-6-4-18(5-7-19)35-10-12-43-13-11-35/h1-8,14,22-25,38H,9-13,15-16H2 |
| InChIKey | KSDPIZKKVLLLOA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|