C31H28Cl2FN3O6 — CID 3270770
6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-8-methyl-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3270770) has the molecular formula C31H28Cl2FN3O6 and a molecular weight of 628.48 g/mol. Its IUPAC name is 6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-8-methyl-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-8-methyl-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3270770 |
| Molecular Formula | C31H28Cl2FN3O6 |
| Molecular Weight | 628.48 g/mol |
| Exact Mass | 627.13 |
| IUPAC Name | 6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-8-methyl-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CN1C(=O)C2(Cl)CC3C(=CCC4C(=O)N(c5ccc(N6CCOCC6)cc5)C(=O)C43)C(c3ccc(O)c(F)c3)C2(Cl)C1=O |
| InChI | InChI=1S/C31H28Cl2FN3O6/c1-35-28(41)30(32)15-21-19(25(31(30,33)29(35)42)16-2-9-23(38)22(34)14-16)7-8-20-24(21)27(40)37(26(20)39)18-5-3-17(4-6-18)36-10-12-43-13-11-36/h2-7,9,14,20-21,24-25,38H,8,10-13,15H2,1H3 |
| InChIKey | IJWNZXZSOCAYNQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|