C31H29Cl2N3O6 — CID 5052684
6a,9a-dichloro-6-(3-hydroxyphenyl)-8-methyl-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5052684) has the molecular formula C31H29Cl2N3O6 and a molecular weight of 610.49 g/mol. Its IUPAC name is 6a,9a-dichloro-6-(3-hydroxyphenyl)-8-methyl-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-6-(3-hydroxyphenyl)-8-methyl-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5052684 |
| Molecular Formula | C31H29Cl2N3O6 |
| Molecular Weight | 610.49 g/mol |
| Exact Mass | 609.14 |
| IUPAC Name | 6a,9a-dichloro-6-(3-hydroxyphenyl)-8-methyl-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CN1C(=O)C2(Cl)CC3C(=CCC4C(=O)N(c5ccc(N6CCOCC6)cc5)C(=O)C43)C(c3cccc(O)c3)C2(Cl)C1=O |
| InChI | InChI=1S/C31H29Cl2N3O6/c1-34-28(40)30(32)16-23-21(25(31(30,33)29(34)41)17-3-2-4-20(37)15-17)9-10-22-24(23)27(39)36(26(22)38)19-7-5-18(6-8-19)35-11-13-42-14-12-35/h2-9,15,22-25,37H,10-14,16H2,1H3 |
| InChIKey | JEJIWXCVRFBTKI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|