C32H31Cl2N3O7 — CID 4149233
6a,9a-dichloro-6-(2-hydroxy-4-methoxyphenyl)-8-methyl-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4149233) has the molecular formula C32H31Cl2N3O7 and a molecular weight of 640.52 g/mol. Its IUPAC name is 6a,9a-dichloro-6-(2-hydroxy-4-methoxyphenyl)-8-methyl-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-6-(2-hydroxy-4-methoxyphenyl)-8-methyl-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4149233 |
| Molecular Formula | C32H31Cl2N3O7 |
| Molecular Weight | 640.52 g/mol |
| Exact Mass | 639.15 |
| IUPAC Name | 6a,9a-dichloro-6-(2-hydroxy-4-methoxyphenyl)-8-methyl-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C2C3=CCC4C(=O)N(c5ccc(N6CCOCC6)cc5)C(=O)C4C3CC3(Cl)C(=O)N(C)C(=O)C23Cl)c(O)c1 |
| InChI | InChI=1S/C32H31Cl2N3O7/c1-35-29(41)31(33)16-23-20(26(32(31,34)30(35)42)21-8-7-19(43-2)15-24(21)38)9-10-22-25(23)28(40)37(27(22)39)18-5-3-17(4-6-18)36-11-13-44-14-12-36/h3-9,15,22-23,25-26,38H,10-14,16H2,1-2H3 |
| InChIKey | VIVGFQSQMBPOSN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|