C30H26Cl2N2O6 — CID 3468593
6a,9a-dichloro-2-(4-ethenylphenyl)-6-(2-hydroxy-5-methoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3468593) has the molecular formula C30H26Cl2N2O6 and a molecular weight of 581.45 g/mol. Its IUPAC name is 6a,9a-dichloro-2-(4-ethenylphenyl)-6-(2-hydroxy-5-methoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-2-(4-ethenylphenyl)-6-(2-hydroxy-5-methoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3468593 |
| Molecular Formula | C30H26Cl2N2O6 |
| Molecular Weight | 581.45 g/mol |
| Exact Mass | 580.12 |
| IUPAC Name | 6a,9a-dichloro-2-(4-ethenylphenyl)-6-(2-hydroxy-5-methoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | C=Cc1ccc(N2C(=O)C3CC=C4C(CC5(Cl)C(=O)N(C)C(=O)C5(Cl)C4c4cc(OC)ccc4O)C3C2=O)cc1 |
| InChI | InChI=1S/C30H26Cl2N2O6/c1-4-15-5-7-16(8-6-15)34-25(36)19-11-10-18-21(23(19)26(34)37)14-29(31)27(38)33(2)28(39)30(29,32)24(18)20-13-17(40-3)9-12-22(20)35/h4-10,12-13,19,21,23-24,35H,1,11,14H2,2-3H3 |
| InChIKey | BVJCSHLMQNSLJO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|