C27H21BrCl2N2O5 — CID 3618417
6-(5-bromo-2-hydroxyphenyl)-6a,9a-dichloro-8-methyl-2-phenyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3618417) has the molecular formula C27H21BrCl2N2O5 and a molecular weight of 604.28 g/mol. Its IUPAC name is 6-(5-bromo-2-hydroxyphenyl)-6a,9a-dichloro-8-methyl-2-phenyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(5-bromo-2-hydroxyphenyl)-6a,9a-dichloro-8-methyl-2-phenyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3618417 |
| Molecular Formula | C27H21BrCl2N2O5 |
| Molecular Weight | 604.28 g/mol |
| Exact Mass | 602.00 |
| IUPAC Name | 6-(5-bromo-2-hydroxyphenyl)-6a,9a-dichloro-8-methyl-2-phenyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CN1C(=O)C2(Cl)CC3C(=CCC4C(=O)N(c5ccccc5)C(=O)C43)C(c3cc(Br)ccc3O)C2(Cl)C1=O |
| InChI | InChI=1S/C27H21BrCl2N2O5/c1-31-24(36)26(29)12-18-15(21(27(26,30)25(31)37)17-11-13(28)7-10-19(17)33)8-9-16-20(18)23(35)32(22(16)34)14-5-3-2-4-6-14/h2-8,10-11,16,18,20-21,33H,9,12H2,1H3 |
| InChIKey | NKTGDEVAHVUNKD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|