C24H21BrCl2N2O7 — CID 6643006
3-[(3aS,6R,6aS,9aR,10aS,10bR)-6-(5-bromo-2-hydroxyphenyl)-6a,9a-dichloro-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid (PubChem CID 6643006) has the molecular formula C24H21BrCl2N2O7 and a molecular weight of 600.25 g/mol. Its IUPAC name is 3-[(3aS,6R,6aS,9aR,10aS,10bR)-6-(5-bromo-2-hydroxyphenyl)-6a,9a-dichloro-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[(3aS,6R,6aS,9aR,10aS,10bR)-6-(5-bromo-2-hydroxyphenyl)-6a,9a-dichloro-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 6643006 |
| Molecular Formula | C24H21BrCl2N2O7 |
| Molecular Weight | 600.25 g/mol |
| Exact Mass | 597.99 |
| IUPAC Name | 3-[(3aS,6R,6aS,9aR,10aS,10bR)-6-(5-bromo-2-hydroxyphenyl)-6a,9a-dichloro-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid |
| SMILES | CN1C(=O)[C@]2(Cl)C[C@@H]3C(=CC[C@@H]4C(=O)N(CCC(=O)O)C(=O)[C@@H]43)[C@H](c3cc(Br)ccc3O)[C@]2(Cl)C1=O |
| InChI | InChI=1S/C24H21BrCl2N2O7/c1-28-21(35)23(26)9-14-11(3-4-12-17(14)20(34)29(19(12)33)7-6-16(31)32)18(24(23,27)22(28)36)13-8-10(25)2-5-15(13)30/h2-3,5,8,12,14,17-18,30H,4,6-7,9H2,1H3,(H,31,32)/t12-,14+,17-,18+,23+,24-/m0/s1 |
| InChIKey | SVBUXPYAKFIRKK-PMBBGVIBSA-N |
| XLogP | 2.62 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|