C25H24Cl2N2O7 — CID 4548039
3-[6a,9a-dichloro-6-(2-hydroxy-3-methylphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid (PubChem CID 4548039) has the molecular formula C25H24Cl2N2O7 and a molecular weight of 535.38 g/mol. Its IUPAC name is 3-[6a,9a-dichloro-6-(2-hydroxy-3-methylphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[6a,9a-dichloro-6-(2-hydroxy-3-methylphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 4548039 |
| Molecular Formula | C25H24Cl2N2O7 |
| Molecular Weight | 535.38 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | 3-[6a,9a-dichloro-6-(2-hydroxy-3-methylphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid |
| SMILES | Cc1cccc(C2C3=CCC4C(=O)N(CCC(=O)O)C(=O)C4C3CC3(Cl)C(=O)N(C)C(=O)C23Cl)c1O |
| InChI | InChI=1S/C25H24Cl2N2O7/c1-11-4-3-5-14(19(11)32)18-12-6-7-13-17(21(34)29(20(13)33)9-8-16(30)31)15(12)10-24(26)22(35)28(2)23(36)25(18,24)27/h3-6,13,15,17-18,32H,7-10H2,1-2H3,(H,30,31) |
| InChIKey | IQSWLQDSSIYJME-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|