C25H23BrCl2N2O8 — CID 4066635
3-[8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-3-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid (PubChem CID 4066635) has the molecular formula C25H23BrCl2N2O8 and a molecular weight of 630.28 g/mol. Its IUPAC name is 3-[8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-3-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-3-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 4066635 |
| Molecular Formula | C25H23BrCl2N2O8 |
| Molecular Weight | 630.28 g/mol |
| Exact Mass | 628.00 |
| IUPAC Name | 3-[8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-3-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid |
| SMILES | COc1cccc(C2C3=CCC4C(=O)N(CCC(=O)O)C(=O)C4C3CC3(Cl)C(=O)N(CBr)C(=O)C23Cl)c1O |
| InChI | InChI=1S/C25H23BrCl2N2O8/c1-38-15-4-2-3-13(19(15)33)18-11-5-6-12-17(21(35)29(20(12)34)8-7-16(31)32)14(11)9-24(27)22(36)30(10-26)23(37)25(18,24)28/h2-5,12,14,17-18,33H,6-10H2,1H3,(H,31,32) |
| InChIKey | ARTPAOSSBKVDPU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|