C25H24Cl2N2O8 — CID 6645438
3-[(3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-(4-hydroxy-2-methoxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid (PubChem CID 6645438) has the molecular formula C25H24Cl2N2O8 and a molecular weight of 551.38 g/mol. Its IUPAC name is 3-[(3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-(4-hydroxy-2-methoxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[(3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-(4-hydroxy-2-methoxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 6645438 |
| Molecular Formula | C25H24Cl2N2O8 |
| Molecular Weight | 551.38 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | 3-[(3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-(4-hydroxy-2-methoxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid |
| SMILES | COc1cc(O)ccc1[C@H]1C2=CC[C@@H]3C(=O)N(CCC(=O)O)C(=O)[C@@H]3[C@@H]2C[C@@]2(Cl)C(=O)N(C)C(=O)[C@@]12Cl |
| InChI | InChI=1S/C25H24Cl2N2O8/c1-28-22(35)24(26)10-15-12(5-6-14-18(15)21(34)29(20(14)33)8-7-17(31)32)19(25(24,27)23(28)36)13-4-3-11(30)9-16(13)37-2/h3-5,9,14-15,18-19,30H,6-8,10H2,1-2H3,(H,31,32)/t14-,15+,18-,19+,24+,25-/m0/s1 |
| InChIKey | TYSWYNYPXOFBRS-OYICUQNTSA-N |
| XLogP | 1.86 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|