C28H30Cl2N2O8 — CID 4208735
6-[6a,9a-dichloro-6-(3-hydroxy-4-methoxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]hexanoic acid (PubChem CID 4208735) has the molecular formula C28H30Cl2N2O8 and a molecular weight of 593.46 g/mol. Its IUPAC name is 6-[6a,9a-dichloro-6-(3-hydroxy-4-methoxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]hexanoic acid.
| Compound Name | 6-[6a,9a-dichloro-6-(3-hydroxy-4-methoxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 4208735 |
| Molecular Formula | C28H30Cl2N2O8 |
| Molecular Weight | 593.46 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | 6-[6a,9a-dichloro-6-(3-hydroxy-4-methoxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]hexanoic acid |
| SMILES | COc1ccc(C2C3=CCC4C(=O)N(CCCCCC(=O)O)C(=O)C4C3CC3(Cl)C(=O)N(C)C(=O)C23Cl)cc1O |
| InChI | InChI=1S/C28H30Cl2N2O8/c1-31-25(38)27(29)13-17-15(22(28(27,30)26(31)39)14-7-10-19(40-2)18(33)12-14)8-9-16-21(17)24(37)32(23(16)36)11-5-3-4-6-20(34)35/h7-8,10,12,16-17,21-22,33H,3-6,9,11,13H2,1-2H3,(H,34,35) |
| InChIKey | DZIYTSSMUCVORC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|