C27H28Cl2N2O8 — CID 6647415
4-[(3aS,6S,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-[4-(2-hydroxyethoxy)phenyl]-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid (PubChem CID 6647415) has the molecular formula C27H28Cl2N2O8 and a molecular weight of 579.43 g/mol. Its IUPAC name is 4-[(3aS,6S,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-[4-(2-hydroxyethoxy)phenyl]-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[(3aS,6S,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-[4-(2-hydroxyethoxy)phenyl]-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 6647415 |
| Molecular Formula | C27H28Cl2N2O8 |
| Molecular Weight | 579.43 g/mol |
| Exact Mass | 578.12 |
| IUPAC Name | 4-[(3aS,6S,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-[4-(2-hydroxyethoxy)phenyl]-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid |
| SMILES | CN1C(=O)[C@]2(Cl)C[C@@H]3C(=CC[C@@H]4C(=O)N(CCCC(=O)O)C(=O)[C@@H]43)[C@H](c3ccc(OCCO)cc3)[C@]2(Cl)C1=O |
| InChI | InChI=1S/C27H28Cl2N2O8/c1-30-24(37)26(28)13-18-16(8-9-17-20(18)23(36)31(22(17)35)10-2-3-19(33)34)21(27(26,29)25(30)38)14-4-6-15(7-5-14)39-12-11-32/h4-8,17-18,20-21,32H,2-3,9-13H2,1H3,(H,33,34)/t17-,18+,20-,21-,26+,27-/m0/s1 |
| InChIKey | CYWOCFRYHHUFAM-ZXSRDTPWSA-N |
| XLogP | 1.91 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|