C31H27Cl2FN2O8 — CID 3604601
3-[6a,9a-dichloro-8-(4-fluorophenyl)-6-[4-(2-hydroxyethoxy)phenyl]-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid (PubChem CID 3604601) has the molecular formula C31H27Cl2FN2O8 and a molecular weight of 645.47 g/mol. Its IUPAC name is 3-[6a,9a-dichloro-8-(4-fluorophenyl)-6-[4-(2-hydroxyethoxy)phenyl]-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[6a,9a-dichloro-8-(4-fluorophenyl)-6-[4-(2-hydroxyethoxy)phenyl]-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 3604601 |
| Molecular Formula | C31H27Cl2FN2O8 |
| Molecular Weight | 645.47 g/mol |
| Exact Mass | 644.11 |
| IUPAC Name | 3-[6a,9a-dichloro-8-(4-fluorophenyl)-6-[4-(2-hydroxyethoxy)phenyl]-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)C2CC=C3C(CC4(Cl)C(=O)N(c5ccc(F)cc5)C(=O)C4(Cl)C3c3ccc(OCCO)cc3)C2C1=O |
| InChI | InChI=1S/C31H27Cl2FN2O8/c32-30-15-22-20(9-10-21-24(22)27(41)35(26(21)40)12-11-23(38)39)25(16-1-7-19(8-2-16)44-14-13-37)31(30,33)29(43)36(28(30)42)18-5-3-17(34)4-6-18/h1-9,21-22,24-25,37H,10-15H2,(H,38,39) |
| InChIKey | GLQLXGLXGPOCSN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|