C24H24Cl2N2O8 — CID 4149857
4-[6a,9a-dichloro-6-[5-(hydroxymethyl)furan-2-yl]-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid (PubChem CID 4149857) has the molecular formula C24H24Cl2N2O8 and a molecular weight of 539.37 g/mol. Its IUPAC name is 4-[6a,9a-dichloro-6-[5-(hydroxymethyl)furan-2-yl]-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[6a,9a-dichloro-6-[5-(hydroxymethyl)furan-2-yl]-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 4149857 |
| Molecular Formula | C24H24Cl2N2O8 |
| Molecular Weight | 539.37 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 4-[6a,9a-dichloro-6-[5-(hydroxymethyl)furan-2-yl]-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid |
| SMILES | CN1C(=O)C2(Cl)CC3C(=CCC4C(=O)N(CCCC(=O)O)C(=O)C43)C(c3ccc(CO)o3)C2(Cl)C1=O |
| InChI | InChI=1S/C24H24Cl2N2O8/c1-27-21(34)23(25)9-14-12(18(24(23,26)22(27)35)15-7-4-11(10-29)36-15)5-6-13-17(14)20(33)28(19(13)32)8-2-3-16(30)31/h4-5,7,13-14,17-18,29H,2-3,6,8-10H2,1H3,(H,30,31) |
| InChIKey | NSXMRIYNDGQQTI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|