C25H23Cl2FN2O7 — CID 3487580
4-[6a,9a-dichloro-6-(3-fluoro-2-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid (PubChem CID 3487580) has the molecular formula C25H23Cl2FN2O7 and a molecular weight of 553.37 g/mol. Its IUPAC name is 4-[6a,9a-dichloro-6-(3-fluoro-2-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[6a,9a-dichloro-6-(3-fluoro-2-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 3487580 |
| Molecular Formula | C25H23Cl2FN2O7 |
| Molecular Weight | 553.37 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | 4-[6a,9a-dichloro-6-(3-fluoro-2-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid |
| SMILES | CN1C(=O)C2(Cl)CC3C(=CCC4C(=O)N(CCCC(=O)O)C(=O)C43)C(c3cccc(F)c3O)C2(Cl)C1=O |
| InChI | InChI=1S/C25H23Cl2FN2O7/c1-29-22(36)24(26)10-14-11(18(25(24,27)23(29)37)13-4-2-5-15(28)19(13)33)7-8-12-17(14)21(35)30(20(12)34)9-3-6-16(31)32/h2,4-5,7,12,14,17-18,33H,3,6,8-10H2,1H3,(H,31,32) |
| InChIKey | WTWLVZALEVIAQD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|