C22H18Cl2FN3O6 — CID 5067775
6a,9a-dichloro-6-(3-fluoro-2-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide (PubChem CID 5067775) has the molecular formula C22H18Cl2FN3O6 and a molecular weight of 510.31 g/mol. Its IUPAC name is 6a,9a-dichloro-6-(3-fluoro-2-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide.
| Compound Name | 6a,9a-dichloro-6-(3-fluoro-2-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 5067775 |
| Molecular Formula | C22H18Cl2FN3O6 |
| Molecular Weight | 510.31 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | 6a,9a-dichloro-6-(3-fluoro-2-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide |
| SMILES | CN1C(=O)C2(Cl)CC3C(=CCC4C(=O)N(C(N)=O)C(=O)C43)C(c3cccc(F)c3O)C2(Cl)C1=O |
| InChI | InChI=1S/C22H18Cl2FN3O6/c1-27-18(32)21(23)7-11-8(5-6-9-13(11)17(31)28(16(9)30)20(26)34)14(22(21,24)19(27)33)10-3-2-4-12(25)15(10)29/h2-5,9,11,13-14,29H,6-7H2,1H3,(H2,26,34) |
| InChIKey | ISICRPSOHAHHDB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 138.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|