C22H19Cl2N3O6 — CID 4149232
6a,9a-dichloro-6-(2-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide (PubChem CID 4149232) has the molecular formula C22H19Cl2N3O6 and a molecular weight of 492.32 g/mol. Its IUPAC name is 6a,9a-dichloro-6-(2-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide.
| Compound Name | 6a,9a-dichloro-6-(2-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 4149232 |
| Molecular Formula | C22H19Cl2N3O6 |
| Molecular Weight | 492.32 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | 6a,9a-dichloro-6-(2-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide |
| SMILES | CN1C(=O)C2(Cl)CC3C(=CCC4C(=O)N(C(N)=O)C(=O)C43)C(c3ccccc3O)C2(Cl)C1=O |
| InChI | InChI=1S/C22H19Cl2N3O6/c1-26-18(31)21(23)8-12-9(6-7-11-14(12)17(30)27(16(11)29)20(25)33)15(22(21,24)19(26)32)10-4-2-3-5-13(10)28/h2-6,11-12,14-15,28H,7-8H2,1H3,(H2,25,33) |
| InChIKey | ORQKVSAPHLEYDO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 138.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|