C24H23Cl2N3O7 — CID 4681963
6a,9a-dichloro-6-(3-ethoxy-4-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide (PubChem CID 4681963) has the molecular formula C24H23Cl2N3O7 and a molecular weight of 536.37 g/mol. Its IUPAC name is 6a,9a-dichloro-6-(3-ethoxy-4-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide.
| Compound Name | 6a,9a-dichloro-6-(3-ethoxy-4-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 4681963 |
| Molecular Formula | C24H23Cl2N3O7 |
| Molecular Weight | 536.37 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | 6a,9a-dichloro-6-(3-ethoxy-4-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide |
| SMILES | CCOc1cc(C2C3=CCC4C(=O)N(C(N)=O)C(=O)C4C3CC3(Cl)C(=O)N(C)C(=O)C23Cl)ccc1O |
| InChI | InChI=1S/C24H23Cl2N3O7/c1-3-36-15-8-10(4-7-14(15)30)17-11-5-6-12-16(19(32)29(18(12)31)22(27)35)13(11)9-23(25)20(33)28(2)21(34)24(17,23)26/h4-5,7-8,12-13,16-17,30H,3,6,9H2,1-2H3,(H2,27,35) |
| InChIKey | NLRPVXMNKPHDKL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 147.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|