C23H22Cl2N2O7 — CID 5058249
6a,9a-dichloro-6-(3-ethoxy-4-hydroxyphenyl)-2-hydroxy-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5058249) has the molecular formula C23H22Cl2N2O7 and a molecular weight of 509.34 g/mol. Its IUPAC name is 6a,9a-dichloro-6-(3-ethoxy-4-hydroxyphenyl)-2-hydroxy-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-6-(3-ethoxy-4-hydroxyphenyl)-2-hydroxy-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5058249 |
| Molecular Formula | C23H22Cl2N2O7 |
| Molecular Weight | 509.34 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | 6a,9a-dichloro-6-(3-ethoxy-4-hydroxyphenyl)-2-hydroxy-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCOc1cc(C2C3=CCC4C(=O)N(O)C(=O)C4C3CC3(Cl)C(=O)N(C)C(=O)C23Cl)ccc1O |
| InChI | InChI=1S/C23H22Cl2N2O7/c1-3-34-15-8-10(4-7-14(15)28)17-11-5-6-12-16(19(30)27(33)18(12)29)13(11)9-22(24)20(31)26(2)21(32)23(17,22)25/h4-5,7-8,12-13,16-17,28,33H,3,6,9H2,1-2H3 |
| InChIKey | JBSBMLIQWCQNCW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|