C22H19Cl2IN2O7 — CID 4248555
6a,9a-dichloro-2-hydroxy-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4248555) has the molecular formula C22H19Cl2IN2O7 and a molecular weight of 621.21 g/mol. Its IUPAC name is 6a,9a-dichloro-2-hydroxy-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-2-hydroxy-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4248555 |
| Molecular Formula | C22H19Cl2IN2O7 |
| Molecular Weight | 621.21 g/mol |
| Exact Mass | 619.96 |
| IUPAC Name | 6a,9a-dichloro-2-hydroxy-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(O)C(=O)C4C3CC3(Cl)C(=O)N(C)C(=O)C23Cl)cc(I)c1O |
| InChI | InChI=1S/C22H19Cl2IN2O7/c1-26-19(31)21(23)7-11-9(3-4-10-14(11)18(30)27(33)17(10)29)15(22(21,24)20(26)32)8-5-12(25)16(28)13(6-8)34-2/h3,5-6,10-11,14-15,28,33H,4,7H2,1-2H3 |
| InChIKey | JOJQZNRRLHPIME-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|