C30H21Cl2F6IN2O6 — CID 3495475
2-[3,5-bis(trifluoromethyl)phenyl]-6a,9a-dichloro-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3495475) has the molecular formula C30H21Cl2F6IN2O6 and a molecular weight of 817.30 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-6a,9a-dichloro-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-6a,9a-dichloro-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3495475 |
| Molecular Formula | C30H21Cl2F6IN2O6 |
| Molecular Weight | 817.30 g/mol |
| Exact Mass | 815.97 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-6a,9a-dichloro-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5cc(C(F)(F)F)cc(C(F)(F)F)c5)C(=O)C4C3CC3(Cl)C(=O)N(C)C(=O)C23Cl)cc(I)c1O |
| InChI | InChI=1S/C30H21Cl2F6IN2O6/c1-40-25(45)27(31)10-17-15(21(28(27,32)26(40)46)11-5-18(39)22(42)19(6-11)47-2)3-4-16-20(17)24(44)41(23(16)43)14-8-12(29(33,34)35)7-13(9-14)30(36,37)38/h3,5-9,16-17,20-21,42H,4,10H2,1-2H3 |
| InChIKey | LKNCXJMERMUSQX-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.30 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|