C28H29Cl2IN2O6 — CID 4248550
6a,9a-dichloro-2-cyclohexyl-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4248550) has the molecular formula C28H29Cl2IN2O6 and a molecular weight of 687.36 g/mol. Its IUPAC name is 6a,9a-dichloro-2-cyclohexyl-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-2-cyclohexyl-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4248550 |
| Molecular Formula | C28H29Cl2IN2O6 |
| Molecular Weight | 687.36 g/mol |
| Exact Mass | 686.04 |
| IUPAC Name | 6a,9a-dichloro-2-cyclohexyl-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(C5CCCCC5)C(=O)C4C3CC3(Cl)C(=O)N(C)C(=O)C23Cl)cc(I)c1O |
| InChI | InChI=1S/C28H29Cl2IN2O6/c1-32-25(37)27(29)12-17-15(8-9-16-20(17)24(36)33(23(16)35)14-6-4-3-5-7-14)21(28(27,30)26(32)38)13-10-18(31)22(34)19(11-13)39-2/h8,10-11,14,16-17,20-21,34H,3-7,9,12H2,1-2H3 |
| InChIKey | HFODABGDZCAKOW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|