C25H24Cl2N2O8 — CID 4189180
methyl 6a,9a-dichloro-6-(3-ethoxy-4-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 4189180) has the molecular formula C25H24Cl2N2O8 and a molecular weight of 551.38 g/mol. Its IUPAC name is methyl 6a,9a-dichloro-6-(3-ethoxy-4-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl 6a,9a-dichloro-6-(3-ethoxy-4-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 4189180 |
| Molecular Formula | C25H24Cl2N2O8 |
| Molecular Weight | 551.38 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | methyl 6a,9a-dichloro-6-(3-ethoxy-4-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | CCOc1cc(C2C3=CCC4C(=O)N(C(=O)OC)C(=O)C4C3CC3(Cl)C(=O)N(C)C(=O)C23Cl)ccc1O |
| InChI | InChI=1S/C25H24Cl2N2O8/c1-4-37-16-9-11(5-8-15(16)30)18-12-6-7-13-17(20(32)29(19(13)31)23(35)36-3)14(12)10-24(26)21(33)28(2)22(34)25(18,24)27/h5-6,8-9,13-14,17-18,30H,4,7,10H2,1-3H3 |
| InChIKey | NFYLHQBKUAVUJV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|