C23H18BrCl2FN2O7 — CID 5109577
methyl 8-(bromomethyl)-6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 5109577) has the molecular formula C23H18BrCl2FN2O7 and a molecular weight of 604.21 g/mol. Its IUPAC name is methyl 8-(bromomethyl)-6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl 8-(bromomethyl)-6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 5109577 |
| Molecular Formula | C23H18BrCl2FN2O7 |
| Molecular Weight | 604.21 g/mol |
| Exact Mass | 601.97 |
| IUPAC Name | methyl 8-(bromomethyl)-6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)C2CC=C3C(CC4(Cl)C(=O)N(CBr)C(=O)C4(Cl)C3c3ccc(O)c(F)c3)C2C1=O |
| InChI | InChI=1S/C23H18BrCl2FN2O7/c1-36-21(35)29-17(31)11-4-3-10-12(15(11)18(29)32)7-22(25)19(33)28(8-24)20(34)23(22,26)16(10)9-2-5-14(30)13(27)6-9/h2-3,5-6,11-12,15-16,30H,4,7-8H2,1H3 |
| InChIKey | HWZQIWMOSRCMND-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.21 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|