C24H19Br3Cl2N2O8 — CID 4107332
methyl 8-(bromomethyl)-6a,9a-dichloro-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 4107332) has the molecular formula C24H19Br3Cl2N2O8 and a molecular weight of 774.04 g/mol. Its IUPAC name is methyl 8-(bromomethyl)-6a,9a-dichloro-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl 8-(bromomethyl)-6a,9a-dichloro-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 4107332 |
| Molecular Formula | C24H19Br3Cl2N2O8 |
| Molecular Weight | 774.04 g/mol |
| Exact Mass | 769.81 |
| IUPAC Name | methyl 8-(bromomethyl)-6a,9a-dichloro-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)C2CC=C3C(CC4(Cl)C(=O)N(CBr)C(=O)C4(Cl)C3c3cc(OC)c(O)c(Br)c3Br)C2C1=O |
| InChI | InChI=1S/C24H19Br3Cl2N2O8/c1-38-12-5-10(15(26)16(27)17(12)32)14-8-3-4-9-13(19(34)31(18(9)33)22(37)39-2)11(8)6-23(28)20(35)30(7-25)21(36)24(14,23)29/h3,5,9,11,13-14,32H,4,6-7H2,1-2H3 |
| InChIKey | KBNLJRPIEMHOTJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.04 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|