C22H17Br2Cl2N3O6 — CID 4581469
6-(5-bromo-2-hydroxyphenyl)-8-(bromomethyl)-6a,9a-dichloro-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide (PubChem CID 4581469) has the molecular formula C22H17Br2Cl2N3O6 and a molecular weight of 650.11 g/mol. Its IUPAC name is 6-(5-bromo-2-hydroxyphenyl)-8-(bromomethyl)-6a,9a-dichloro-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide.
| Compound Name | 6-(5-bromo-2-hydroxyphenyl)-8-(bromomethyl)-6a,9a-dichloro-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 4581469 |
| Molecular Formula | C22H17Br2Cl2N3O6 |
| Molecular Weight | 650.11 g/mol |
| Exact Mass | 646.89 |
| IUPAC Name | 6-(5-bromo-2-hydroxyphenyl)-8-(bromomethyl)-6a,9a-dichloro-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide |
| SMILES | NC(=O)N1C(=O)C2CC=C3C(CC4(Cl)C(=O)N(CBr)C(=O)C4(Cl)C3c3cc(Br)ccc3O)C2C1=O |
| InChI | InChI=1S/C22H17Br2Cl2N3O6/c23-7-28-18(33)21(25)6-12-9(2-3-10-14(12)17(32)29(16(10)31)20(27)35)15(22(21,26)19(28)34)11-5-8(24)1-4-13(11)30/h1-2,4-5,10,12,14-15,30H,3,6-7H2,(H2,27,35) |
| InChIKey | RDHFHRGJWWUDAT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 138.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.11 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|