C25H22Br2Cl2N2O7 — CID 5075616
4-[6-(5-bromo-2-hydroxyphenyl)-8-(bromomethyl)-6a,9a-dichloro-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid (PubChem CID 5075616) has the molecular formula C25H22Br2Cl2N2O7 and a molecular weight of 693.17 g/mol. Its IUPAC name is 4-[6-(5-bromo-2-hydroxyphenyl)-8-(bromomethyl)-6a,9a-dichloro-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[6-(5-bromo-2-hydroxyphenyl)-8-(bromomethyl)-6a,9a-dichloro-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 5075616 |
| Molecular Formula | C25H22Br2Cl2N2O7 |
| Molecular Weight | 693.17 g/mol |
| Exact Mass | 689.92 |
| IUPAC Name | 4-[6-(5-bromo-2-hydroxyphenyl)-8-(bromomethyl)-6a,9a-dichloro-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C2CC=C3C(CC4(Cl)C(=O)N(CBr)C(=O)C4(Cl)C3c3cc(Br)ccc3O)C2C1=O |
| InChI | InChI=1S/C25H22Br2Cl2N2O7/c26-10-31-22(37)24(28)9-15-12(19(25(24,29)23(31)38)14-8-11(27)3-6-16(14)32)4-5-13-18(15)21(36)30(20(13)35)7-1-2-17(33)34/h3-4,6,8,13,15,18-19,32H,1-2,5,7,9-10H2,(H,33,34) |
| InChIKey | JIBTZFFYSYNOPL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.17 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|