C26H25BrCl2N2O7 — CID 4096112
4-[8-(bromomethyl)-6a,9a-dichloro-6-(4-hydroxy-3-methylphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid (PubChem CID 4096112) has the molecular formula C26H25BrCl2N2O7 and a molecular weight of 628.30 g/mol. Its IUPAC name is 4-[8-(bromomethyl)-6a,9a-dichloro-6-(4-hydroxy-3-methylphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[8-(bromomethyl)-6a,9a-dichloro-6-(4-hydroxy-3-methylphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 4096112 |
| Molecular Formula | C26H25BrCl2N2O7 |
| Molecular Weight | 628.30 g/mol |
| Exact Mass | 626.02 |
| IUPAC Name | 4-[8-(bromomethyl)-6a,9a-dichloro-6-(4-hydroxy-3-methylphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid |
| SMILES | Cc1cc(C2C3=CCC4C(=O)N(CCCC(=O)O)C(=O)C4C3CC3(Cl)C(=O)N(CBr)C(=O)C23Cl)ccc1O |
| InChI | InChI=1S/C26H25BrCl2N2O7/c1-12-9-13(4-7-17(12)32)20-14-5-6-15-19(22(36)30(21(15)35)8-2-3-18(33)34)16(14)10-25(28)23(37)31(11-27)24(38)26(20,25)29/h4-5,7,9,15-16,19-20,32H,2-3,6,8,10-11H2,1H3,(H,33,34) |
| InChIKey | MMXKTHPQECLTPX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|