C34H26Cl2N2O6 — CID 3337983
2-(4-benzoylphenyl)-6a,9a-dichloro-6-(2-hydroxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3337983) has the molecular formula C34H26Cl2N2O6 and a molecular weight of 629.50 g/mol. Its IUPAC name is 2-(4-benzoylphenyl)-6a,9a-dichloro-6-(2-hydroxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-benzoylphenyl)-6a,9a-dichloro-6-(2-hydroxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3337983 |
| Molecular Formula | C34H26Cl2N2O6 |
| Molecular Weight | 629.50 g/mol |
| Exact Mass | 628.12 |
| IUPAC Name | 2-(4-benzoylphenyl)-6a,9a-dichloro-6-(2-hydroxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CN1C(=O)C2(Cl)CC3C(=CCC4C(=O)N(c5ccc(C(=O)c6ccccc6)cc5)C(=O)C43)C(c3ccccc3O)C2(Cl)C1=O |
| InChI | InChI=1S/C34H26Cl2N2O6/c1-37-31(43)33(35)17-24-21(27(34(33,36)32(37)44)22-9-5-6-10-25(22)39)15-16-23-26(24)30(42)38(29(23)41)20-13-11-19(12-14-20)28(40)18-7-3-2-4-8-18/h2-15,23-24,26-27,39H,16-17H2,1H3 |
| InChIKey | NYMYRQMYCVNHDM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|