C32H24Cl2N2O7 — CID 4575381
3-[6a,9a-dichloro-6-(1-hydroxynaphthalen-2-yl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid (PubChem CID 4575381) has the molecular formula C32H24Cl2N2O7 and a molecular weight of 619.46 g/mol. Its IUPAC name is 3-[6a,9a-dichloro-6-(1-hydroxynaphthalen-2-yl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[6a,9a-dichloro-6-(1-hydroxynaphthalen-2-yl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 4575381 |
| Molecular Formula | C32H24Cl2N2O7 |
| Molecular Weight | 619.46 g/mol |
| Exact Mass | 618.10 |
| IUPAC Name | 3-[6a,9a-dichloro-6-(1-hydroxynaphthalen-2-yl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid |
| SMILES | CN1C(=O)C2(Cl)CC3C(=CCC4C(=O)N(c5cccc(C(=O)O)c5)C(=O)C43)C(c3ccc4ccccc4c3O)C2(Cl)C1=O |
| InChI | InChI=1S/C32H24Cl2N2O7/c1-35-29(42)31(33)14-22-19(24(32(31,34)30(35)43)21-10-9-15-5-2-3-8-18(15)25(21)37)11-12-20-23(22)27(39)36(26(20)38)17-7-4-6-16(13-17)28(40)41/h2-11,13,20,22-24,37H,12,14H2,1H3,(H,40,41) |
| InChIKey | YCWFXAYKJKFWRA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|