C38H27Cl2N3O6 — CID 4648785
2-[4-(1,3-benzoxazol-2-yl)phenyl]-6a,9a-dichloro-6-(1-hydroxynaphthalen-2-yl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4648785) has the molecular formula C38H27Cl2N3O6 and a molecular weight of 692.56 g/mol. Its IUPAC name is 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6a,9a-dichloro-6-(1-hydroxynaphthalen-2-yl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6a,9a-dichloro-6-(1-hydroxynaphthalen-2-yl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4648785 |
| Molecular Formula | C38H27Cl2N3O6 |
| Molecular Weight | 692.56 g/mol |
| Exact Mass | 691.13 |
| IUPAC Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6a,9a-dichloro-6-(1-hydroxynaphthalen-2-yl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CN1C(=O)C2(Cl)CC3C(=CCC4C(=O)N(c5ccc(-c6nc7ccccc7o6)cc5)C(=O)C43)C(c3ccc4ccccc4c3O)C2(Cl)C1=O |
| InChI | InChI=1S/C38H27Cl2N3O6/c1-42-35(47)37(39)18-26-23(30(38(37,40)36(42)48)25-15-12-19-6-2-3-7-22(19)31(25)44)16-17-24-29(26)34(46)43(33(24)45)21-13-10-20(11-14-21)32-41-27-8-4-5-9-28(27)49-32/h2-16,24,26,29-30,44H,17-18H2,1H3 |
| InChIKey | QUJQXWOWVQHUPD-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.56 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|