C34H25Cl2N3O6 — CID 5112474
2-[4-(1,3-benzoxazol-2-yl)phenyl]-6a,9a-dichloro-6-(4-hydroxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5112474) has the molecular formula C34H25Cl2N3O6 and a molecular weight of 642.50 g/mol. Its IUPAC name is 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6a,9a-dichloro-6-(4-hydroxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6a,9a-dichloro-6-(4-hydroxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5112474 |
| Molecular Formula | C34H25Cl2N3O6 |
| Molecular Weight | 642.50 g/mol |
| Exact Mass | 641.11 |
| IUPAC Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6a,9a-dichloro-6-(4-hydroxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CN1C(=O)C2(Cl)CC3C(=CCC4C(=O)N(c5ccc(-c6nc7ccccc7o6)cc5)C(=O)C43)C(c3ccc(O)cc3)C2(Cl)C1=O |
| InChI | InChI=1S/C34H25Cl2N3O6/c1-38-31(43)33(35)16-23-21(27(34(33,36)32(38)44)17-8-12-20(40)13-9-17)14-15-22-26(23)30(42)39(29(22)41)19-10-6-18(7-11-19)28-37-24-4-2-3-5-25(24)45-28/h2-14,22-23,26-27,40H,15-16H2,1H3 |
| InChIKey | OCZCNCFIAMNASH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|