C36H29Cl2N3O8 — CID 4282693
2-[4-(1,3-benzoxazol-2-yl)phenyl]-6a,9a-dichloro-6-(4-hydroxy-2,6-dimethoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4282693) has the molecular formula C36H29Cl2N3O8 and a molecular weight of 702.55 g/mol. Its IUPAC name is 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6a,9a-dichloro-6-(4-hydroxy-2,6-dimethoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6a,9a-dichloro-6-(4-hydroxy-2,6-dimethoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4282693 |
| Molecular Formula | C36H29Cl2N3O8 |
| Molecular Weight | 702.55 g/mol |
| Exact Mass | 701.13 |
| IUPAC Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6a,9a-dichloro-6-(4-hydroxy-2,6-dimethoxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(O)cc(OC)c1C1C2=CCC3C(=O)N(c4ccc(-c5nc6ccccc6o5)cc4)C(=O)C3C2CC2(Cl)C(=O)N(C)C(=O)C12Cl |
| InChI | InChI=1S/C36H29Cl2N3O8/c1-40-33(45)35(37)16-22-20(29(36(35,38)34(40)46)28-25(47-2)14-19(42)15-26(28)48-3)12-13-21-27(22)32(44)41(31(21)43)18-10-8-17(9-11-18)30-39-23-6-4-5-7-24(23)49-30/h4-12,14-15,21-22,27,29,42H,13,16H2,1-3H3 |
| InChIKey | FZNLZQREQQEYJN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|