C35H26BrCl2N3O7 — CID 4156766
2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(3-bromo-4-hydroxy-5-methoxyphenyl)-6a,9a-dichloro-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4156766) has the molecular formula C35H26BrCl2N3O7 and a molecular weight of 751.42 g/mol. Its IUPAC name is 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(3-bromo-4-hydroxy-5-methoxyphenyl)-6a,9a-dichloro-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(3-bromo-4-hydroxy-5-methoxyphenyl)-6a,9a-dichloro-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4156766 |
| Molecular Formula | C35H26BrCl2N3O7 |
| Molecular Weight | 751.42 g/mol |
| Exact Mass | 749.03 |
| IUPAC Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(3-bromo-4-hydroxy-5-methoxyphenyl)-6a,9a-dichloro-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5ccc(-c6nc7ccccc7o6)cc5)C(=O)C4C3CC3(Cl)C(=O)N(C)C(=O)C23Cl)cc(Br)c1O |
| InChI | InChI=1S/C35H26BrCl2N3O7/c1-40-32(45)34(37)15-21-19(27(35(34,38)33(40)46)17-13-22(36)28(42)25(14-17)47-2)11-12-20-26(21)31(44)41(30(20)43)18-9-7-16(8-10-18)29-39-23-5-3-4-6-24(23)48-29/h3-11,13-14,20-21,26-27,42H,12,15H2,1-2H3 |
| InChIKey | VEZUVCWRZIWIHK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.42 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|