C49H38N2O8 — CID 4653903
2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(4-hydroxy-3,5-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4653903) has the molecular formula C49H38N2O8 and a molecular weight of 782.85 g/mol. Its IUPAC name is 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(4-hydroxy-3,5-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(4-hydroxy-3,5-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4653903 |
| Molecular Formula | C49H38N2O8 |
| Molecular Weight | 782.85 g/mol |
| Exact Mass | 782.26 |
| IUPAC Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(4-hydroxy-3,5-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5ccc(-c6nc7ccccc7o6)cc5)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C32c2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C49H38N2O8/c1-57-39-23-29(24-40(58-2)45(39)54)43-32-21-22-33-42(48(56)51(47(33)55)31-19-17-28(18-20-31)46-50-37-15-9-10-16-38(37)59-46)35(32)25-36-44(53)34(27-11-5-3-6-12-27)26-41(52)49(36,43)30-13-7-4-8-14-30/h3-21,23-24,26,33,35-36,42-43,54H,22,25H2,1-2H3 |
| InChIKey | WRAQXNHMQBINHO-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 136.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.85 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|