C47H37IN2O6 — CID 4175352
2-(4-anilinophenyl)-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4175352) has the molecular formula C47H37IN2O6 and a molecular weight of 852.73 g/mol. Its IUPAC name is 2-(4-anilinophenyl)-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-anilinophenyl)-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4175352 |
| Molecular Formula | C47H37IN2O6 |
| Molecular Weight | 852.73 g/mol |
| Exact Mass | 852.17 |
| IUPAC Name | 2-(4-anilinophenyl)-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5ccc(Nc6ccccc6)cc5)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C32c2ccccc2)cc(I)c1O |
| InChI | InChI=1S/C47H37IN2O6/c1-56-39-24-28(23-38(48)44(39)53)42-33-21-22-34-41(46(55)50(45(34)54)32-19-17-31(18-20-32)49-30-15-9-4-10-16-30)36(33)25-37-43(52)35(27-11-5-2-6-12-27)26-40(51)47(37,42)29-13-7-3-8-14-29/h2-21,23-24,26,34,36-37,41-42,49,53H,22,25H2,1H3 |
| InChIKey | ZKIVMSKNYQGBMY-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.73 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|