C46H36N2O5 — CID 5067473
2-(4-anilinophenyl)-6-(4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5067473) has the molecular formula C46H36N2O5 and a molecular weight of 696.80 g/mol. Its IUPAC name is 2-(4-anilinophenyl)-6-(4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-anilinophenyl)-6-(4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5067473 |
| Molecular Formula | C46H36N2O5 |
| Molecular Weight | 696.80 g/mol |
| Exact Mass | 696.26 |
| IUPAC Name | 2-(4-anilinophenyl)-6-(4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C(c2ccccc2)=CC(=O)C2(c3ccccc3)C1CC1C(=CCC3C(=O)N(c4ccc(Nc5ccccc5)cc4)C(=O)C31)C2c1ccc(O)cc1 |
| InChI | InChI=1S/C46H36N2O5/c49-34-22-16-29(17-23-34)42-35-24-25-36-41(45(53)48(44(36)52)33-20-18-32(19-21-33)47-31-14-8-3-9-15-31)38(35)26-39-43(51)37(28-10-4-1-5-11-28)27-40(50)46(39,42)30-12-6-2-7-13-30/h1-24,27,36,38-39,41-42,47,49H,25-26H2 |
| InChIKey | BGZMVUOILXDSID-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.80 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|