C34H27NO6 — CID 5048969
2-hydroxy-6-(4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5048969) has the molecular formula C34H27NO6 and a molecular weight of 545.59 g/mol. Its IUPAC name is 2-hydroxy-6-(4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-hydroxy-6-(4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5048969 |
| Molecular Formula | C34H27NO6 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | 2-hydroxy-6-(4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C(c2ccccc2)=CC(=O)C2(c3ccccc3)C1CC1C(=CCC3C(=O)N(O)C(=O)C31)C2c1ccc(O)cc1 |
| InChI | InChI=1S/C34H27NO6/c36-22-13-11-20(12-14-22)30-23-15-16-24-29(33(40)35(41)32(24)39)26(23)17-27-31(38)25(19-7-3-1-4-8-19)18-28(37)34(27,30)21-9-5-2-6-10-21/h1-15,18,24,26-27,29-30,36,41H,16-17H2 |
| InChIKey | BEJOWCRDZXAJJL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|