C37H31NO7 — CID 6660942
3-[(3aS,6S,6aS,10aR,11aS,11bR)-6-(4-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]propanoic acid (PubChem CID 6660942) has the molecular formula C37H31NO7 and a molecular weight of 601.66 g/mol. Its IUPAC name is 3-[(3aS,6S,6aS,10aR,11aS,11bR)-6-(4-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[(3aS,6S,6aS,10aR,11aS,11bR)-6-(4-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 6660942 |
| Molecular Formula | C37H31NO7 |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 601.21 |
| IUPAC Name | 3-[(3aS,6S,6aS,10aR,11aS,11bR)-6-(4-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)[C@H]2[C@H](CC=C3[C@H]2C[C@H]2C(=O)C(c4ccccc4)=CC(=O)[C@@]2(c2ccccc2)[C@H]3c2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C37H31NO7/c39-24-13-11-22(12-14-24)33-25-15-16-26-32(36(45)38(35(26)44)18-17-31(41)42)28(25)19-29-34(43)27(21-7-3-1-4-8-21)20-30(40)37(29,33)23-9-5-2-6-10-23/h1-15,20,26,28-29,32-33,39H,16-19H2,(H,41,42)/t26-,28+,29-,32-,33-,37-/m0/s1 |
| InChIKey | UXZYUQBSLQRUEZ-FQNDJIRSSA-N |
| XLogP | 4.69 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|