C42H35NO7 — CID 6661665
4-[(3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxynaphthalen-1-yl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]butanoic acid (PubChem CID 6661665) has the molecular formula C42H35NO7 and a molecular weight of 665.74 g/mol. Its IUPAC name is 4-[(3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxynaphthalen-1-yl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[(3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxynaphthalen-1-yl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 6661665 |
| Molecular Formula | C42H35NO7 |
| Molecular Weight | 665.74 g/mol |
| Exact Mass | 665.24 |
| IUPAC Name | 4-[(3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxynaphthalen-1-yl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)[C@H]2[C@H](CC=C3[C@H]2C[C@H]2C(=O)C(c4ccccc4)=CC(=O)[C@@]2(c2ccccc2)[C@H]3c2c(O)ccc3ccccc23)C1=O |
| InChI | InChI=1S/C42H35NO7/c44-33-20-17-25-12-7-8-15-27(25)37(33)38-28-18-19-29-36(41(50)43(40(29)49)21-9-16-35(46)47)31(28)22-32-39(48)30(24-10-3-1-4-11-24)23-34(45)42(32,38)26-13-5-2-6-14-26/h1-8,10-15,17-18,20,23,29,31-32,36,38,44H,9,16,19,21-22H2,(H,46,47)/t29-,31+,32-,36-,38+,42-/m0/s1 |
| InChIKey | IPZLNVXLESLHHH-FZVZFETBSA-N |
| XLogP | 6.23 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.74 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|