C40H37NO8 — CID 5207075
4-[6-(3-ethoxy-4-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]butanoic acid (PubChem CID 5207075) has the molecular formula C40H37NO8 and a molecular weight of 659.74 g/mol. Its IUPAC name is 4-[6-(3-ethoxy-4-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[6-(3-ethoxy-4-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 5207075 |
| Molecular Formula | C40H37NO8 |
| Molecular Weight | 659.74 g/mol |
| Exact Mass | 659.25 |
| IUPAC Name | 4-[6-(3-ethoxy-4-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]butanoic acid |
| SMILES | CCOc1cc(C2C3=CCC4C(=O)N(CCCC(=O)O)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C32c2ccccc2)ccc1O |
| InChI | InChI=1S/C40H37NO8/c1-2-49-32-20-24(15-18-31(32)42)36-26-16-17-27-35(39(48)41(38(27)47)19-9-14-34(44)45)29(26)21-30-37(46)28(23-10-5-3-6-11-23)22-33(43)40(30,36)25-12-7-4-8-13-25/h3-8,10-13,15-16,18,20,22,27,29-30,35-36,42H,2,9,14,17,19,21H2,1H3,(H,44,45) |
| InChIKey | ZTXSXADMTMMPEB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.74 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|