C42H41NO6 — CID 4671604
2-cyclohexyl-6-(3-ethoxy-4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4671604) has the molecular formula C42H41NO6 and a molecular weight of 655.79 g/mol. Its IUPAC name is 2-cyclohexyl-6-(3-ethoxy-4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-cyclohexyl-6-(3-ethoxy-4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4671604 |
| Molecular Formula | C42H41NO6 |
| Molecular Weight | 655.79 g/mol |
| Exact Mass | 655.29 |
| IUPAC Name | 2-cyclohexyl-6-(3-ethoxy-4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CCOc1cc(C2C3=CCC4C(=O)N(C5CCCCC5)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C32c2ccccc2)ccc1O |
| InChI | InChI=1S/C42H41NO6/c1-2-49-35-22-26(18-21-34(35)44)38-29-19-20-30-37(41(48)43(40(30)47)28-16-10-5-11-17-28)32(29)23-33-39(46)31(25-12-6-3-7-13-25)24-36(45)42(33,38)27-14-8-4-9-15-27/h3-4,6-9,12-15,18-19,21-22,24,28,30,32-33,37-38,44H,2,5,10-11,16-17,20,23H2,1H3 |
| InChIKey | SRSLGRICQMBYEA-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.79 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|