C43H31F6NO6 — CID 3348617
2-[3,5-bis(trifluoromethyl)phenyl]-6-(4-hydroxy-3-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3348617) has the molecular formula C43H31F6NO6 and a molecular weight of 771.71 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-6-(4-hydroxy-3-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-6-(4-hydroxy-3-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3348617 |
| Molecular Formula | C43H31F6NO6 |
| Molecular Weight | 771.71 g/mol |
| Exact Mass | 771.21 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-6-(4-hydroxy-3-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5cc(C(F)(F)F)cc(C(F)(F)F)c5)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C32c2ccccc2)ccc1O |
| InChI | InChI=1S/C43H31F6NO6/c1-56-34-16-23(12-15-33(34)51)37-28-13-14-29-36(40(55)50(39(29)54)27-18-25(42(44,45)46)17-26(19-27)43(47,48)49)31(28)20-32-38(53)30(22-8-4-2-5-9-22)21-35(52)41(32,37)24-10-6-3-7-11-24/h2-13,15-19,21,29,31-32,36-37,51H,14,20H2,1H3 |
| InChIKey | IEUDTLQDIXVUGK-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.71 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|