C39H37NO6 — CID 4104388
2-tert-butyl-6-(3-hydroxy-4-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4104388) has the molecular formula C39H37NO6 and a molecular weight of 615.73 g/mol. Its IUPAC name is 2-tert-butyl-6-(3-hydroxy-4-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-tert-butyl-6-(3-hydroxy-4-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4104388 |
| Molecular Formula | C39H37NO6 |
| Molecular Weight | 615.73 g/mol |
| Exact Mass | 615.26 |
| IUPAC Name | 2-tert-butyl-6-(3-hydroxy-4-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1ccc(C2C3=CCC4C(=O)N(C(C)(C)C)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C32c2ccccc2)cc1O |
| InChI | InChI=1S/C39H37NO6/c1-38(2,3)40-36(44)26-17-16-25-28(33(26)37(40)45)20-29-35(43)27(22-11-7-5-8-12-22)21-32(42)39(29,24-13-9-6-10-14-24)34(25)23-15-18-31(46-4)30(41)19-23/h5-16,18-19,21,26,28-29,33-34,41H,17,20H2,1-4H3 |
| InChIKey | WFGPKVLHPVMVRQ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.73 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|