C35H29NO7 — CID 4129074
2-hydroxy-6-(4-hydroxy-2-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4129074) has the molecular formula C35H29NO7 and a molecular weight of 575.62 g/mol. Its IUPAC name is 2-hydroxy-6-(4-hydroxy-2-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-hydroxy-6-(4-hydroxy-2-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4129074 |
| Molecular Formula | C35H29NO7 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | 2-hydroxy-6-(4-hydroxy-2-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(O)ccc1C1C2=CCC3C(=O)N(O)C(=O)C3C2CC2C(=O)C(c3ccccc3)=CC(=O)C21c1ccccc1 |
| InChI | InChI=1S/C35H29NO7/c1-43-28-16-21(37)12-13-23(28)31-22-14-15-24-30(34(41)36(42)33(24)40)26(22)17-27-32(39)25(19-8-4-2-5-9-19)18-29(38)35(27,31)20-10-6-3-7-11-20/h2-14,16,18,24,26-27,30-31,37,42H,15,17H2,1H3 |
| InChIKey | XHSXQRRAXHWFIX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|