C43H35NO7 — CID 4549824
2-(4-acetylphenyl)-6-(4-hydroxy-2-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4549824) has the molecular formula C43H35NO7 and a molecular weight of 677.75 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-6-(4-hydroxy-2-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-acetylphenyl)-6-(4-hydroxy-2-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4549824 |
| Molecular Formula | C43H35NO7 |
| Molecular Weight | 677.75 g/mol |
| Exact Mass | 677.24 |
| IUPAC Name | 2-(4-acetylphenyl)-6-(4-hydroxy-2-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(O)ccc1C1C2=CCC3C(=O)N(c4ccc(C(C)=O)cc4)C(=O)C3C2CC2C(=O)C(c3ccccc3)=CC(=O)C21c1ccccc1 |
| InChI | InChI=1S/C43H35NO7/c1-24(45)25-13-15-28(16-14-25)44-41(49)32-20-19-30-34(38(32)42(44)50)22-35-40(48)33(26-9-5-3-6-10-26)23-37(47)43(35,27-11-7-4-8-12-27)39(30)31-18-17-29(46)21-36(31)51-2/h3-19,21,23,32,34-35,38-39,46H,20,22H2,1-2H3 |
| InChIKey | AFOCNTBSKSKLRW-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.75 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|